CAS 192775-41-0 is the registry number for 4-Nitrobenzeneethanesulfonic Acid. Offered by: TRC. Available pack sizes: 1g, 2,5g, 5g.
2-(4-nitrophenyl)ethanesulfonic acid (CAS 192775-41-0) is a chemical compound with the molecular formula C8H9NO5S and a molecular weight of 231.23 g/mol. IUPAC name: 2-(4-nitrophenyl)ethanesulfonic acid. InChIKey: ZXUUIASPKLVBEL-UHFFFAOYSA-N.
| Molecular formula | C8H9NO5S |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | 2-(4-nitrophenyl)ethanesulfonic acid |
| InChIKey | ZXUUIASPKLVBEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCS(=O)(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)