cas: 328032-91-3 — see every product listed under this CAS number, including other names
3-(AZEPANE-1-SULFONYL)-4-CHLORO-BENZOIC ACID, 97%, 97% (CAS 328032-91-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7N2-100mg |
| cas | 328032-91-3 |
| size | 100mg |
| availability | 10.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 434.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(azepan-1-ylsulfonyl)-4-chlorobenzoic acid (CAS 328032-91-3) is a chemical compound with the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. IUPAC name: 3-(azepan-1-ylsulfonyl)-4-chlorobenzoic acid. InChIKey: BXTRTBOJIIUKFA-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO4S |
|---|---|
| Molecular weight | 317.79 g/mol |
| IUPAC name | 3-(azepan-1-ylsulfonyl)-4-chlorobenzoic acid |
| InChIKey | BXTRTBOJIIUKFA-UHFFFAOYSA-N |
| SMILES | C1CCCN(CC1)S(=O)(=O)C2=C(C=CC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)