Products 1142209-57-1

CAS 1142209-57-1 is the registry number for (1-[(4-Chlorophenyl)sulfonyl]piperidin-4-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]acetic acid (CAS 1142209-57-1) is a chemical compound with the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. IUPAC name: 2-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]acetic acid. InChIKey: UZDQUOZVACHLMK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16ClNO4S
Molecular weight317.79 g/mol
IUPAC name2-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]acetic acid
InChIKeyUZDQUOZVACHLMK-UHFFFAOYSA-N
SMILESC1CN(CCC1CC(=O)O)S(=O)(=O)C2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)