CAS 314744-46-2 appears in our catalog under these names: 1-(4-Chloro-benzenesulfonylamino)-cyclohexanecarboxylic acid, 95%, 1-(4-Chlorophenylsulfonamido)cyclohexanecarboxylic acid, 97%, 1–((4–Chlorophenyl)sulfonamido)cyclohexane–1–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
1-[(4-chlorophenyl)sulfonylamino]cyclohexane-1-carboxylic acid (CAS 314744-46-2) is a chemical compound with the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. IUPAC name: 1-[(4-chlorophenyl)sulfonylamino]cyclohexane-1-carboxylic acid. InChIKey: PCSNDUHMIZCBDH-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO4S |
|---|---|
| Molecular weight | 317.79 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)sulfonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | PCSNDUHMIZCBDH-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C(=O)O)NS(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)