Products 690646-00-5
CAS 690646-00-5 appears in our catalog under these names: 3-(3-Chlorophenylsulfonylamino)cyclohexanecarboxylic acid, 95%, 1–((3–Chlorophenyl)sulfonamido)cyclohexane–1–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg, 50mg.
1-[(3-chlorophenyl)sulfonylamino]cyclohexane-1-carboxylic acid (CAS 690646-00-5) is a chemical compound with the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. IUPAC name: 1-[(3-chlorophenyl)sulfonylamino]cyclohexane-1-carboxylic acid. InChIKey: HYEVABCQNVUEMJ-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO4S |
|---|---|
| Molecular weight | 317.79 g/mol |
| IUPAC name | 1-[(3-chlorophenyl)sulfonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | HYEVABCQNVUEMJ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C(=O)O)NS(=O)(=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)