Products 721418-04-8

CAS 721418-04-8 is the registry number for 4-Chloro-3-(3-methyl-piperidine-1-sulfonyl)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoic acid (CAS 721418-04-8) is a chemical compound with the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. IUPAC name: 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoic acid. InChIKey: QGFTYOUFGPBUIS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16ClNO4S
Molecular weight317.79 g/mol
IUPAC name4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoic acid
InChIKeyQGFTYOUFGPBUIS-UHFFFAOYSA-N
SMILESCC1CCCN(C1)S(=O)(=O)C2=C(C=CC(=C2)C(=O)O)Cl

Computed by PubChem (NCBI)