cas: 2063-92-5 — see every product listed under this CAS number, including other names
3-(Benzyloxy)-2,2-dimethylcyclobutan-1-one 95% (CAS 2063-92-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A646340-100mg |
| cas | 2063-92-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 570.62 Pln | |
| Ambeed | 5g | 1722.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A646340 |
2,2-dimethyl-3-phenylmethoxycyclobutan-1-one (CAS 2063-92-5) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 2,2-dimethyl-3-phenylmethoxycyclobutan-1-one. InChIKey: OQYCKJLAKYHLTP-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | 2,2-dimethyl-3-phenylmethoxycyclobutan-1-one |
| InChIKey | OQYCKJLAKYHLTP-UHFFFAOYSA-N |
| SMILES | CC1(C(CC1=O)OCC2=CC=CC=C2)C |
Computed by PubChem (NCBI)