cas: 1100752-67-7 — see every product listed under this CAS number, including other names
3-(Benzyloxy)-5-chloroaniline, 98%, 98% (CAS 1100752-67-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1195HT-250mg |
| cas | 1100752-67-7 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 491.60 Pln | |
| Chemat | 100mg | 165.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-chloro-5-phenylmethoxyaniline (CAS 1100752-67-7) is a chemical compound with the molecular formula C13H12ClNO and a molecular weight of 233.69 g/mol. IUPAC name: 3-chloro-5-phenylmethoxyaniline. InChIKey: UXNQKFKPKHSVRW-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 3-chloro-5-phenylmethoxyaniline |
| InChIKey | UXNQKFKPKHSVRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)N)Cl |
Computed by PubChem (NCBI)