cas: 1408076-37-8 — see every product listed under this CAS number, including other names
3-(Boc-amino)-3-methylazetidine HCl 97% (CAS 1408076-37-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A594386-10g |
| cas | 1408076-37-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 3624.44 Pln | |
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 2289.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A594386 |
Tert-butyl N-(3-methylazetidin-3-yl)carbamate;hydrochloride (CAS 1408076-37-8) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: tert-butyl N-(3-methylazetidin-3-yl)carbamate;hydrochloride. InChIKey: STEWJDCKUINIMO-UHFFFAOYSA-N.
| Molecular formula | C9H19ClN2O2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | tert-butyl N-(3-methylazetidin-3-yl)carbamate;hydrochloride |
| InChIKey | STEWJDCKUINIMO-UHFFFAOYSA-N |
| SMILES | CC1(CNC1)NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)