cas: 14704-31-5 — see every product listed under this CAS number, including other names
3-(Bromomethyl)-1,1'-biphenyl, >98.0%(GC) (CAS 14704-31-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P3195-1G |
| cas | 14704-31-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 380.45 Pln | |
| TCI | 5g | 921.35 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-(bromomethyl)-3-phenylbenzene (CAS 14704-31-5) is a chemical compound with the molecular formula C13H11Br and a molecular weight of 247.13 g/mol. IUPAC name: 1-(bromomethyl)-3-phenylbenzene. InChIKey: RTFPTPXBTIUISM-UHFFFAOYSA-N.
| Molecular formula | C13H11Br |
|---|---|
| Molecular weight | 247.13 g/mol |
| IUPAC name | 1-(bromomethyl)-3-phenylbenzene |
| InChIKey | RTFPTPXBTIUISM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2)CBr |
Computed by PubChem (NCBI)