cas: 14704-31-5 — see every product listed under this CAS number, including other names
3-Bromomethylbiphenyl, 98% (CAS 14704-31-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036987-1G |
| cas | 14704-31-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 10g | 560.24 Pln | |
| Fluorochem | 25g | 1237.08 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(bromomethyl)-3-phenylbenzene (CAS 14704-31-5) is a chemical compound with the molecular formula C13H11Br and a molecular weight of 247.13 g/mol. IUPAC name: 1-(bromomethyl)-3-phenylbenzene. InChIKey: RTFPTPXBTIUISM-UHFFFAOYSA-N.
| Molecular formula | C13H11Br |
|---|---|
| Molecular weight | 247.13 g/mol |
| IUPAC name | 1-(bromomethyl)-3-phenylbenzene |
| InChIKey | RTFPTPXBTIUISM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2)CBr |
Computed by PubChem (NCBI)