3-(Bromomethyl)-2-methyl-1,1'-biphenyl, 97%
cas: 116175-22-5 — see every product listed under this CAS number, including other names
3-(Bromomethyl)-2-methyl-1,1'-biphenyl, 97% (CAS 116175-22-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F544327-100MG |
| cas | 116175-22-5 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 648.75 Pln | |
| Fluorochem | 250mg | 1216.26 Pln | |
| Fluorochem | 1g | 2882.34 Pln | |
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 1021.19 Pln | |
| Chemat | 100mg | 448.40 Pln | |
| Chemat | 250mg | 832.40 Pln | |
| Chemat | 1g | 1994.00 Pln | |
| BLDpharm | 100mg | 275.48 Pln | |
| BLDpharm | 250mg | 442.09 Pln | |
| BLDpharm | 1g | 1097.42 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
1-(bromomethyl)-2-methyl-3-phenylbenzene (CAS 116175-22-5) is a chemical compound with the molecular formula C14H13Br and a molecular weight of 261.16 g/mol. IUPAC name: 1-(bromomethyl)-2-methyl-3-phenylbenzene. InChIKey: UTCWKKQFHHVEPP-UHFFFAOYSA-N.
| Molecular formula | C14H13Br |
|---|---|
| Molecular weight | 261.16 g/mol |
| IUPAC name | 1-(bromomethyl)-2-methyl-3-phenylbenzene |
| InChIKey | UTCWKKQFHHVEPP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1C2=CC=CC=C2)CBr |
Computed by PubChem (NCBI)