CAS 79757-93-0 is the registry number for 4-(Bromomethyl)-4'-Methyl-1,1'-Biphenyl. Offered by: Chemat Brand. Available pack sizes: on request.
1-(bromomethyl)-4-(4-methylphenyl)benzene (CAS 79757-93-0) is a chemical compound with the molecular formula C14H13Br and a molecular weight of 261.16 g/mol. IUPAC name: 1-(bromomethyl)-4-(4-methylphenyl)benzene. InChIKey: CNEBYCQCJMBAJI-UHFFFAOYSA-N.
| Molecular formula | C14H13Br |
|---|---|
| Molecular weight | 261.16 g/mol |
| IUPAC name | 1-(bromomethyl)-4-(4-methylphenyl)benzene |
| InChIKey | CNEBYCQCJMBAJI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)CBr |
Computed by PubChem (NCBI)