CAS 1809158-13-1 appears in our catalog under these names: 4-Bromo-2-ethylbiphenyl, 95%, 4-Bromo-2-ethyl-1,1'-biphenyl, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
4-bromo-2-ethyl-1-phenylbenzene (CAS 1809158-13-1) is a chemical compound with the molecular formula C14H13Br and a molecular weight of 261.16 g/mol. IUPAC name: 4-bromo-2-ethyl-1-phenylbenzene. InChIKey: BWSROJHYPQKRJH-UHFFFAOYSA-N.
| Molecular formula | C14H13Br |
|---|---|
| Molecular weight | 261.16 g/mol |
| IUPAC name | 4-bromo-2-ethyl-1-phenylbenzene |
| InChIKey | BWSROJHYPQKRJH-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)Br)C2=CC=CC=C2 |
Computed by PubChem (NCBI)