CAS 756873-19-5 appears in our catalog under these names: 4-Bromo-3,5-dimethyl-1,1'-biphenyl, 95%, 4-Bromo-3,5-dimethyl-1,1'-biphenyl, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
2-bromo-1,3-dimethyl-5-phenylbenzene (CAS 756873-19-5) is a chemical compound with the molecular formula C14H13Br and a molecular weight of 261.16 g/mol. IUPAC name: 2-bromo-1,3-dimethyl-5-phenylbenzene. InChIKey: OBGLZCFMKVODIR-UHFFFAOYSA-N.
| Molecular formula | C14H13Br |
|---|---|
| Molecular weight | 261.16 g/mol |
| IUPAC name | 2-bromo-1,3-dimethyl-5-phenylbenzene |
| InChIKey | OBGLZCFMKVODIR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)