cas: 25934-52-5 — see every product listed under this CAS number, including other names
3-(Cyclopropylmethoxy)-4-hydroxybenzaldehyde, 95%, 95% (CAS 25934-52-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113R4Q-250mg |
| cas | 25934-52-5 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 626.00 Pln | |
| Chemat | 5g | 2891.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(cyclopropylmethoxy)-4-hydroxybenzaldehyde (CAS 25934-52-5) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 3-(cyclopropylmethoxy)-4-hydroxybenzaldehyde. InChIKey: MLAZVBDTWHMFRL-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 3-(cyclopropylmethoxy)-4-hydroxybenzaldehyde |
| InChIKey | MLAZVBDTWHMFRL-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=C(C=CC(=C2)C=O)O |
Computed by PubChem (NCBI)