3-(Cyclopropylmethoxy)-4-hydroxybenzoic acid, 97%
cas: 1243391-44-7 — see every product listed under this CAS number, including other names
3-(Cyclopropylmethoxy)-4-hydroxybenzoic acid, 97% (CAS 1243391-44-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 50mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A272982-250mg |
| cas | 1243391-44-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 426.00 Pln | |
| Ambeed | 1g | 1021.19 Pln | |
| Ambeed | 5g | 4508.88 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 573.20 Pln | |
| Chemat | 5g | 2570.00 Pln | |
| BLDpharm | 50mg | 247.72 Pln | |
| BLDpharm | 100mg | 347.68 Pln | |
| BLDpharm | 250mg | 453.20 Pln | |
| BLDpharm | 1g | 1097.42 Pln | |
| BLDpharm | 5g | 4834.99 Pln | |
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 430.07 Pln | |
| Fluorochem | 1g | 1054.85 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-(cyclopropylmethoxy)-4-hydroxybenzoic acid (CAS 1243391-44-7) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 3-(cyclopropylmethoxy)-4-hydroxybenzoic acid. InChIKey: CPGNRCZMIIWDPZ-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 3-(cyclopropylmethoxy)-4-hydroxybenzoic acid |
| InChIKey | CPGNRCZMIIWDPZ-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=C(C=CC(=C2)C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(Cyclopropylmethoxy)-4-hydroxybenzoic acid, Benzoic acid, 3-(cyclopropylmethoxy)-4-hydroxy-, Roflumilast Impurity I, Roflumilast Impurity D, Roflumilast-4, related substance D, RofluMilast IMp.D, Roflumilast Impurity 7Q: What is, 3-(Cyclopropylmethoxy)-4-hydroxybenzoicacid, 3-(cyclopropylmethoxy)-4-hydroxy-benzoic acid