cas: 313231-71-9 — see every product listed under this CAS number, including other names
3-(Imidazo[1,2-a]pyridin-2-yl)aniline 95% (CAS 313231-71-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A350525-100mg |
| cas | 313231-71-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 409.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A350525 |
3-imidazo[1,2-a]pyridin-2-ylaniline (CAS 313231-71-9) is a chemical compound with the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. IUPAC name: 3-imidazo[1,2-a]pyridin-2-ylaniline. InChIKey: NUVDPCZHQLYLPU-UHFFFAOYSA-N.
| Molecular formula | C13H11N3 |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 3-imidazo[1,2-a]pyridin-2-ylaniline |
| InChIKey | NUVDPCZHQLYLPU-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)