cas: 313231-71-9 — see every product listed under this CAS number, including other names
3-(Imidazo[1,2-a]pyridin-2-yl)aniline, 95%, 95% (CAS 313231-71-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118HKL-100mg |
| cas | 313231-71-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 371.60 Pln | |
| Chemat | 1g | 683.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-imidazo[1,2-a]pyridin-2-ylaniline (CAS 313231-71-9) is a chemical compound with the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. IUPAC name: 3-imidazo[1,2-a]pyridin-2-ylaniline. InChIKey: NUVDPCZHQLYLPU-UHFFFAOYSA-N.
| Molecular formula | C13H11N3 |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 3-imidazo[1,2-a]pyridin-2-ylaniline |
| InChIKey | NUVDPCZHQLYLPU-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)