cas: 1016715-95-9 — see every product listed under this CAS number, including other names
3-(Methylcarbamoyl)benzenesulfonyl chloride 98% (CAS 1016715-95-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A477491-100mg |
| cas | 1016715-95-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 604.00 Pln | |
| Ambeed | 1g | 1327.12 Pln | |
| Ambeed | 5g | 3841.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A477491 |
3-(methylcarbamoyl)benzenesulfonyl chloride (CAS 1016715-95-9) is a chemical compound with the molecular formula C8H8ClNO3S and a molecular weight of 233.67 g/mol. IUPAC name: 3-(methylcarbamoyl)benzenesulfonyl chloride. InChIKey: XRJDVAPXWOSTLA-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3S |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | 3-(methylcarbamoyl)benzenesulfonyl chloride |
| InChIKey | XRJDVAPXWOSTLA-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)