CAS 2350-44-9 appears in our catalog under these names: 5-Acetyl-2-chlorobenzene-1-sulfonamide, 95%, 5-Acetyl-2-chlorobenzene-1-sulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
5-acetyl-2-chlorobenzenesulfonamide (CAS 2350-44-9) is a chemical compound with the molecular formula C8H8ClNO3S and a molecular weight of 233.67 g/mol. IUPAC name: 5-acetyl-2-chlorobenzenesulfonamide. InChIKey: BCZGXDORRDXENN-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3S |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | 5-acetyl-2-chlorobenzenesulfonamide |
| InChIKey | BCZGXDORRDXENN-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)