Products 1016715-95-9

CAS 1016715-95-9 appears in our catalog under these names: 3-(Methylcarbamoyl)benzenesulfonyl chloride, 97%, 3–((Methylamino)carbonyl)benzenesulfonyl chloride, 3-((Methylamino)carbonyl)benzenesulfonyl chloride, 3-(Methylcarbamoyl)benzenesulfonyl chloride 98%, 3-(Methylcarbamoyl)benzenesulfonyl chloride, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 0,5g, 100mg.

Structural formula: {0} (CAS {1})

3-(methylcarbamoyl)benzenesulfonyl chloride (CAS 1016715-95-9) is a chemical compound with the molecular formula C8H8ClNO3S and a molecular weight of 233.67 g/mol. IUPAC name: 3-(methylcarbamoyl)benzenesulfonyl chloride. InChIKey: XRJDVAPXWOSTLA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClNO3S
Molecular weight233.67 g/mol
IUPAC name3-(methylcarbamoyl)benzenesulfonyl chloride
InChIKeyXRJDVAPXWOSTLA-UHFFFAOYSA-N
SMILESCNC(=O)C1=CC(=CC=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)