Products 1779132-08-9
CAS 1779132-08-9 is the registry number for 1-[(2-Chloropyridin-3-yl)sulfonyl]acetone, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[(2-chloro-3-pyridinyl)sulfonyl]propan-2-one (CAS 1779132-08-9) is a chemical compound with the molecular formula C8H8ClNO3S and a molecular weight of 233.67 g/mol. IUPAC name: 1-[(2-chloro-3-pyridinyl)sulfonyl]propan-2-one. InChIKey: QDGKJAVYSQEKNR-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3S |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | 1-[(2-chloro-3-pyridinyl)sulfonyl]propan-2-one |
| InChIKey | QDGKJAVYSQEKNR-UHFFFAOYSA-N |
| SMILES | CC(=O)CS(=O)(=O)C1=C(N=CC=C1)Cl |
Computed by PubChem (NCBI)