Products 121-60-8
CAS 121-60-8 appears in our catalog under these names: N-Acetylsulfanilyl chloride, 95%, N-Acetylsulfanilyl chloride, 4-(Acetylamino)benzenesulfonyl Chloride, N–Acetylsulfanilyl chloride, N-Acetylsulfanilyl chloride, 99%. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: 5g, 100g, 500g, 1kg, 25g, on request, 250g, 0,25kg.
4-acetamidobenzenesulfonyl chloride (CAS 121-60-8) is a chemical compound with the molecular formula C8H8ClNO3S and a molecular weight of 233.67 g/mol. IUPAC name: 4-acetamidobenzenesulfonyl chloride. InChIKey: GRDXCFKBQWDAJH-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3S |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | 4-acetamidobenzenesulfonyl chloride |
| InChIKey | GRDXCFKBQWDAJH-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
N-Acetylsulfanilyl chloride, 4-Acetamidobenzenesulfonyl chloride, 4-Acetamidobenzene-1-Sulfonyl Chloride, Dagenan chloride, 4-Acetamidophenylsulfonyl chloride, Benzenesulfonyl chloride, 4-(acetylamino)-, p-Acetamidobenzenesulfonyl chloride, Acetylsulfanilyl chloride, p-Acetaminobenzenesulfonyl chloride, Acetanilide-p-sulfonyl chloride