cas: 832695-88-2 — see every product listed under this CAS number, including other names
3-(N-Methylaminocarbonyl)phenylboronic acid, 98%, 98% (CAS 832695-88-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115TUS-250mg |
| cas | 832695-88-2 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 10g | 510.80 Pln | |
| Chemat | 25g | 962.00 Pln | |
| Chemat | 100mg | 83.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[3-(methylcarbamoyl)phenyl]boronic acid (CAS 832695-88-2) is a chemical compound with the molecular formula C8H10BNO3 and a molecular weight of 178.98 g/mol. IUPAC name: [3-(methylcarbamoyl)phenyl]boronic acid. InChIKey: FYFFPNFUVMBPRZ-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO3 |
|---|---|
| Molecular weight | 178.98 g/mol |
| IUPAC name | [3-(methylcarbamoyl)phenyl]boronic acid |
| InChIKey | FYFFPNFUVMBPRZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC)(O)O |
Computed by PubChem (NCBI)