cas: 85553-53-3 — see every product listed under this CAS number, including other names
3-(Pyridin-2-yl)benzaldehyde 96% (CAS 85553-53-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A485205-100mg |
| cas | 85553-53-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 993.38 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A485205 |
3-pyridin-2-ylbenzaldehyde (CAS 85553-53-3) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: 3-pyridin-2-ylbenzaldehyde. InChIKey: SAPNGHSAYQXRPG-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 3-pyridin-2-ylbenzaldehyde |
| InChIKey | SAPNGHSAYQXRPG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)