cas: 379216-53-2 — see every product listed under this CAS number, including other names
3-(Tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentan-1-one, 95%, 95% (CAS 379216-53-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8GL-100mg |
| cas | 379216-53-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 410.00 Pln | |
| Chemat | 250mg | 640.40 Pln | |
| Chemat | 1g | 1821.20 Pln | |
| Chemat | 5g | 6050.00 Pln | |
| Chemat | 10g | 10043.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentan-1-one (CAS 379216-53-2) is a chemical compound with the molecular formula C11H19BO3 and a molecular weight of 210.08 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentan-1-one. InChIKey: UGLFXZQPFUVKQB-UHFFFAOYSA-N.
| Molecular formula | C11H19BO3 |
|---|---|
| Molecular weight | 210.08 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentan-1-one |
| InChIKey | UGLFXZQPFUVKQB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCC(=O)C2 |
Computed by PubChem (NCBI)