CAS 237386-01-5 is the registry number for 2-Bromo-3'-trifluoromethoxyacetophenone, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
2-bromo-1-[3-(trifluoromethoxy)phenyl]ethanone (CAS 237386-01-5) is a chemical compound with the molecular formula C9H6BrF3O2 and a molecular weight of 283.04 g/mol. IUPAC name: 2-bromo-1-[3-(trifluoromethoxy)phenyl]ethanone. InChIKey: QUKYVVGHLJGVEQ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O2 |
|---|---|
| Molecular weight | 283.04 g/mol |
| IUPAC name | 2-bromo-1-[3-(trifluoromethoxy)phenyl]ethanone |
| InChIKey | QUKYVVGHLJGVEQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)C(=O)CBr |
Computed by PubChem (NCBI)