3-(Trifluoromethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine, 95%
cas: 624734-27-6 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine, 95% (CAS 624734-27-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A220475-250mg |
| cas | 624734-27-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 709.69 Pln | |
| Ambeed | 1g | 1738.75 Pln | |
| Ambeed | 5g | 5916.19 Pln | |
| Chemat | 100mg | 482.00 Pln | |
| Chemat | 250mg | 731.60 Pln | |
| Chemat | 1g | 1797.20 Pln | |
| Chemat | 5g | 6126.80 Pln | |
| BLDpharm | 100mg | 497.63 Pln | |
| BLDpharm | 250mg | 758.65 Pln | |
| BLDpharm | 1g | 1869.37 Pln | |
| BLDpharm | 5g | 6373.34 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-(trifluoromethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine (CAS 624734-27-6) is a chemical compound with the molecular formula C9H9F3N2 and a molecular weight of 202.18 g/mol. IUPAC name: 3-(trifluoromethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine. InChIKey: YVKYZZSGAOUFGK-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2 |
|---|---|
| Molecular weight | 202.18 g/mol |
| IUPAC name | 3-(trifluoromethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine |
| InChIKey | YVKYZZSGAOUFGK-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1N=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
5,6,7,8-Tetrahydro-3-(trifluoromethyl)-1,6-naphthyridine, 3-(trifluoromethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine, 3-Trifluoromethyl-5,6,7,8-tetrahydro-[1,6]naphthyridine, 5,?6,?7,?8-?Tetrahydro-?3-?(trifluoromethyl)?-1,?6-?naphthyridine, 1,6-Naphthyridine, 5,6,7,8-tetrahydro-3-(trifluoromethyl)-