CAS 794461-85-1 is the registry number for 2-(Trifluoromethyl)-5,6,7,8-tetrahydro-1,7-naphthyridine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(trifluoromethyl)-5,6,7,8-tetrahydro-1,7-naphthyridine (CAS 794461-85-1) is a chemical compound with the molecular formula C9H9F3N2 and a molecular weight of 202.18 g/mol. IUPAC name: 2-(trifluoromethyl)-5,6,7,8-tetrahydro-1,7-naphthyridine. InChIKey: KXEOITUVISETBJ-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2 |
|---|---|
| Molecular weight | 202.18 g/mol |
| IUPAC name | 2-(trifluoromethyl)-5,6,7,8-tetrahydro-1,7-naphthyridine |
| InChIKey | KXEOITUVISETBJ-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C=CC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)