CAS 2088056-53-3 is the registry number for (R)-3-(4,4-Difluoropyrrolidin-2-yl)-5-fluoropyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(2R)-4,4-difluoropyrrolidin-2-yl]-5-fluoropyridine (CAS 2088056-53-3) is a chemical compound with the molecular formula C9H9F3N2 and a molecular weight of 202.18 g/mol. IUPAC name: 3-[(2R)-4,4-difluoropyrrolidin-2-yl]-5-fluoropyridine. InChIKey: UCBJPGXLZYKKNA-MRVPVSSYSA-N.
| Molecular formula | C9H9F3N2 |
|---|---|
| Molecular weight | 202.18 g/mol |
| IUPAC name | 3-[(2R)-4,4-difluoropyrrolidin-2-yl]-5-fluoropyridine |
| InChIKey | UCBJPGXLZYKKNA-MRVPVSSYSA-N |
| SMILES | C1[C@@H](NCC1(F)F)C2=CC(=CN=C2)F |
Computed by PubChem (NCBI)