CAS 87736-82-1 is the registry number for 3-(4-Methylphenyl)-3-(trifluoromethyl)diaziridine. Offered by: TRC. Available pack sizes: 250mg, 25mg.
3-(4-methylphenyl)-3-(trifluoromethyl)diaziridine (CAS 87736-82-1) is a chemical compound with the molecular formula C9H9F3N2 and a molecular weight of 202.18 g/mol. IUPAC name: 3-(4-methylphenyl)-3-(trifluoromethyl)diaziridine. InChIKey: BPIYMEWYYRZJOP-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2 |
|---|---|
| Molecular weight | 202.18 g/mol |
| IUPAC name | 3-(4-methylphenyl)-3-(trifluoromethyl)diaziridine |
| InChIKey | BPIYMEWYYRZJOP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(NN2)C(F)(F)F |
Computed by PubChem (NCBI)