CAS 1211525-01-7 is the registry number for 7-(Trifluoromethyl)-1,2,3,4-tetrahydro-1,5-naphthyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(trifluoromethyl)-1,2,3,4-tetrahydro-1,5-naphthyridine (CAS 1211525-01-7) is a chemical compound with the molecular formula C9H9F3N2 and a molecular weight of 202.18 g/mol. IUPAC name: 7-(trifluoromethyl)-1,2,3,4-tetrahydro-1,5-naphthyridine. InChIKey: HHPPBMRYOABBPZ-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2 |
|---|---|
| Molecular weight | 202.18 g/mol |
| IUPAC name | 7-(trifluoromethyl)-1,2,3,4-tetrahydro-1,5-naphthyridine |
| InChIKey | HHPPBMRYOABBPZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=N2)C(F)(F)F)NC1 |
Computed by PubChem (NCBI)