cas: 78950-34-2 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)phenyl acetate 95+% (CAS 78950-34-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A255031-1g |
| cas | 78950-34-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 592.88 Pln | |
| Ambeed | 10g | 1076.81 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A255031 |
[3-(trifluoromethyl)phenyl] acetate (CAS 78950-34-2) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: [3-(trifluoromethyl)phenyl] acetate. InChIKey: CBAIJJMMUDSHOD-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | [3-(trifluoromethyl)phenyl] acetate |
| InChIKey | CBAIJJMMUDSHOD-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC(=C1)C(F)(F)F |
Computed by PubChem (NCBI)