cas: 342002-80-6 — see every product listed under this CAS number, including other names
3-(iso-Propoxycarbonyl)phenylboronic acid, 98% (CAS 342002-80-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F045289-1G |
| cas | 342002-80-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 25g | 1565.09 Pln | |
| Fluorochem | 100g | 5751.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3-propan-2-yloxycarbonylphenyl)boronic acid (CAS 342002-80-6) is a chemical compound with the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. IUPAC name: (3-propan-2-yloxycarbonylphenyl)boronic acid. InChIKey: HXVODQWMURGQMP-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | (3-propan-2-yloxycarbonylphenyl)boronic acid |
| InChIKey | HXVODQWMURGQMP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)OC(C)C)(O)O |
Computed by PubChem (NCBI)