cas: 284493-59-0 — see every product listed under this CAS number, including other names
3-[(tert-Butoxycarbonyl)amino]-3-(3-fluorophenyl)propanoic acid (CAS 284493-59-0) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F010160-500MG |
| cas | 284493-59-0 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1091.30 Pln | |
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 1g | 893.45 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | no data |
3-(3-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 284493-59-0) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: 3-(3-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: IQPQPXUDXQDVMK-UHFFFAOYSA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | 3-(3-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | IQPQPXUDXQDVMK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)C1=CC(=CC=C1)F |
Computed by PubChem (NCBI)