cas: 1563-01-5 — see every product listed under this CAS number, including other names
3-[2-[4-(Diethylamino)-2-hydroxyphenyl]diazenyl]-4-hydroxybenzenesulfonic acid, ≥90%(HPLC), ≥90%(HPLC) (CAS 1563-01-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112ONJ-50mg |
| cas | 1563-01-5 |
| size | 50mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 98.00 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 227.60 Pln |
| purity | ≥90%(HPLC) |
|---|---|
| delivery time | 3 weeks |
3-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-4-hydroxybenzenesulfonic acid (CAS 1563-01-5) is a chemical compound with the molecular formula C16H19N3O5S and a molecular weight of 365.4 g/mol. IUPAC name: 3-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-4-hydroxybenzenesulfonic acid. InChIKey: DSZXUTUBVLAYLI-UHFFFAOYSA-N.
| Molecular formula | C16H19N3O5S |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 3-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-4-hydroxybenzenesulfonic acid |
| InChIKey | DSZXUTUBVLAYLI-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC(=C(C=C1)N=NC2=C(C=CC(=C2)S(=O)(=O)O)O)O |
Computed by PubChem (NCBI)