cas: 1563-01-5 — see every product listed under this CAS number, including other names
5-Sulfo-4'-diethylamino-2,2'-dihydroxyazobenzene, >90.0%(HPLC)(T) (CAS 1563-01-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | S0128-1G |
| cas | 1563-01-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 285.53 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >90.0%(HPLC)(T) |
3-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-4-hydroxybenzenesulfonic acid (CAS 1563-01-5) is a chemical compound with the molecular formula C16H19N3O5S and a molecular weight of 365.4 g/mol. IUPAC name: 3-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-4-hydroxybenzenesulfonic acid. InChIKey: DSZXUTUBVLAYLI-UHFFFAOYSA-N.
| Molecular formula | C16H19N3O5S |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 3-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-4-hydroxybenzenesulfonic acid |
| InChIKey | DSZXUTUBVLAYLI-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC(=C(C=C1)N=NC2=C(C=CC(=C2)S(=O)(=O)O)O)O |
Computed by PubChem (NCBI)