cas: 119385-80-7 — see every product listed under this CAS number, including other names
3-AMINO-2,4,5-TRIFLUOROBENZOIC ACID, 95%, 95% (CAS 119385-80-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111IO8-100g |
| cas | 119385-80-7 |
| size | 100g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 5694.80 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 640.40 Pln | |
| Chemat | 10g | 1053.20 Pln | |
| Chemat | 25g | 1821.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-amino-2,4,5-trifluorobenzoic acid (CAS 119385-80-7) is a chemical compound with the molecular formula C7H4F3NO2 and a molecular weight of 191.11 g/mol. IUPAC name: 3-amino-2,4,5-trifluorobenzoic acid. InChIKey: NVWVZPFPZJYLNK-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO2 |
|---|---|
| Molecular weight | 191.11 g/mol |
| IUPAC name | 3-amino-2,4,5-trifluorobenzoic acid |
| InChIKey | NVWVZPFPZJYLNK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)N)F)C(=O)O |
Computed by PubChem (NCBI)