cas: 2199-93-1 — see every product listed under this CAS number, including other names
3-Acetyl-6-bromo-2H-chromen-2-one, >97%, >97% (CAS 2199-93-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118OGE-250mg |
| cas | 2199-93-1 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 10g | 405.20 Pln | |
| Chemat | 25g | 880.40 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
3-acetyl-6-bromochromen-2-one (CAS 2199-93-1) is a chemical compound with the molecular formula C11H7BrO3 and a molecular weight of 267.07 g/mol. IUPAC name: 3-acetyl-6-bromochromen-2-one. InChIKey: XFQYOFLFNKCHLG-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO3 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 3-acetyl-6-bromochromen-2-one |
| InChIKey | XFQYOFLFNKCHLG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=CC(=C2)Br)OC1=O |
Computed by PubChem (NCBI)