cas: 2199-93-1 — see every product listed under this CAS number, including other names
3-Acetyl-6-bromocoumarin, 99.12% (CAS 2199-93-1) is a chemical reagent available from Chemat. Available pack sizes: 500 mg, 5 g, 1 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W140869-500 mg |
| cas | 2199-93-1 |
| size | 500 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 500 mg | 259.32 Pln | |
| MedChemExpress | 5 g | 677.28 Pln | |
| MedChemExpress | 1 g | 347.56 Pln | |
| MedChemExpress | 10 g | 1007.00 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.12% |
3-acetyl-6-bromochromen-2-one (CAS 2199-93-1) is a chemical compound with the molecular formula C11H7BrO3 and a molecular weight of 267.07 g/mol. IUPAC name: 3-acetyl-6-bromochromen-2-one. InChIKey: XFQYOFLFNKCHLG-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO3 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 3-acetyl-6-bromochromen-2-one |
| InChIKey | XFQYOFLFNKCHLG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=CC(=C2)Br)OC1=O |
Computed by PubChem (NCBI)