cas: 1186194-01-3 — see every product listed under this CAS number, including other names
3-Amino-2-chloro-6-fluorobenzoic acid, 98%, 98% (CAS 1186194-01-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FUSF-100mg |
| cas | 1186194-01-3 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2296.40 Pln | |
| Chemat | 250mg | 2392.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-amino-2-chloro-6-fluorobenzoic acid (CAS 1186194-01-3) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: 3-amino-2-chloro-6-fluorobenzoic acid. InChIKey: IWIKIGOVSHEYLM-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | 3-amino-2-chloro-6-fluorobenzoic acid |
| InChIKey | IWIKIGOVSHEYLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)Cl)C(=O)O)F |
Computed by PubChem (NCBI)