Products 1124214-25-0
CAS 1124214-25-0 appears in our catalog under these names: 4-Amino-2-chloro-3-fluorobenzoic acid, 95%, 4-Amino-2-chloro-3-fluorobenzoic acid, 81%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.
4-amino-2-chloro-3-fluorobenzoic acid (CAS 1124214-25-0) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: 4-amino-2-chloro-3-fluorobenzoic acid. InChIKey: NHDBDTBRXKRBQV-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | 4-amino-2-chloro-3-fluorobenzoic acid |
| InChIKey | NHDBDTBRXKRBQV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)Cl)F)N |
Computed by PubChem (NCBI)