Products 1186194-01-3
CAS 1186194-01-3 appears in our catalog under these names: 3-Amino-2-chloro-6-fluoro-benzoic acid, 95%, 3-Amino-2-chloro-6-fluorobenzoic acid, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
3-amino-2-chloro-6-fluorobenzoic acid (CAS 1186194-01-3) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: 3-amino-2-chloro-6-fluorobenzoic acid. InChIKey: IWIKIGOVSHEYLM-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | 3-amino-2-chloro-6-fluorobenzoic acid |
| InChIKey | IWIKIGOVSHEYLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)Cl)C(=O)O)F |
Computed by PubChem (NCBI)