Products 1214323-94-0
CAS 1214323-94-0 is the registry number for 2-(5-Chloro-3-fluoropyridin-2-yl)acetic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-(5-chloro-3-fluoro-2-pyridinyl)acetic acid (CAS 1214323-94-0) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: 2-(5-chloro-3-fluoro-2-pyridinyl)acetic acid. InChIKey: LRZZWXBVJOCXJS-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | 2-(5-chloro-3-fluoro-2-pyridinyl)acetic acid |
| InChIKey | LRZZWXBVJOCXJS-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1F)CC(=O)O)Cl |
Computed by PubChem (NCBI)