CAS 172404-33-0 appears in our catalog under these names: 5-Amino-2-chloro-4-fluorobenzoic acid, 98%, 5-Amino-2-chloro-4-fluorobenzoic Acid, 5-Amino-2-chloro-4-fluorobenzoic acid, 95%, 95%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g, 500mg, 100mg, 250mg.
5-amino-2-chloro-4-fluorobenzoic acid (CAS 172404-33-0) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: 5-amino-2-chloro-4-fluorobenzoic acid. InChIKey: GANBUJGJERTPPV-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | 5-amino-2-chloro-4-fluorobenzoic acid |
| InChIKey | GANBUJGJERTPPV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)F)Cl)C(=O)O |
Computed by PubChem (NCBI)