cas: 535-52-4 — see every product listed under this CAS number, including other names
3-Amino-4-fluorobenzotrifluoride, 97% (CAS 535-52-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F003129-25G |
| cas | 535-52-4 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 216.61 Pln | |
| Fluorochem | 500g | 700.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-fluoro-5-(trifluoromethyl)aniline (CAS 535-52-4) is a chemical compound with the molecular formula C7H5F4N and a molecular weight of 179.11 g/mol. IUPAC name: 2-fluoro-5-(trifluoromethyl)aniline. InChIKey: DRKWGMXFFCPZLW-UHFFFAOYSA-N.
| Molecular formula | C7H5F4N |
|---|---|
| Molecular weight | 179.11 g/mol |
| IUPAC name | 2-fluoro-5-(trifluoromethyl)aniline |
| InChIKey | DRKWGMXFFCPZLW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N)F |
Computed by PubChem (NCBI)