CAS 235088-70-7 is the registry number for 2,3,4,5-Tetrafluorobenzylamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,3,4,5-tetrafluorophenyl)methanamine (CAS 235088-70-7) is a chemical compound with the molecular formula C7H5F4N and a molecular weight of 179.11 g/mol. IUPAC name: (2,3,4,5-tetrafluorophenyl)methanamine. InChIKey: HHYMPXUXPDPZGK-UHFFFAOYSA-N.
| Molecular formula | C7H5F4N |
|---|---|
| Molecular weight | 179.11 g/mol |
| IUPAC name | (2,3,4,5-tetrafluorophenyl)methanamine |
| InChIKey | HHYMPXUXPDPZGK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)F)CN |
Computed by PubChem (NCBI)