CAS 69409-98-9 appears in our catalog under these names: 4-Amino-3-fluorobenzotrifluoride 98%, 4-Amino-3-fluorobenzotrifluoride, 98%, 2–Fluoro–4–(trifluoromethyl)aniline. Offered by: Ambeed, Fluorochem, GLPBio. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g.
2-fluoro-4-(trifluoromethyl)aniline (CAS 69409-98-9) is a chemical compound with the molecular formula C7H5F4N and a molecular weight of 179.11 g/mol. IUPAC name: 2-fluoro-4-(trifluoromethyl)aniline. InChIKey: ARHDUOQIXLGANT-UHFFFAOYSA-N.
| Molecular formula | C7H5F4N |
|---|---|
| Molecular weight | 179.11 g/mol |
| IUPAC name | 2-fluoro-4-(trifluoromethyl)aniline |
| InChIKey | ARHDUOQIXLGANT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)F)N |
Computed by PubChem (NCBI)