Products 1445796-39-3
CAS 1445796-39-3 is the registry number for 3-(Difluoromethyl)-4,5-difluoroaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(difluoromethyl)-4,5-difluoroaniline (CAS 1445796-39-3) is a chemical compound with the molecular formula C7H5F4N and a molecular weight of 179.11 g/mol. IUPAC name: 3-(difluoromethyl)-4,5-difluoroaniline. InChIKey: BDOMRCLULHAUAJ-UHFFFAOYSA-N.
| Molecular formula | C7H5F4N |
|---|---|
| Molecular weight | 179.11 g/mol |
| IUPAC name | 3-(difluoromethyl)-4,5-difluoroaniline |
| InChIKey | BDOMRCLULHAUAJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)F)F)F)N |
Computed by PubChem (NCBI)